C23H21N4O3+ — CID 7524407
(2S,3S,10bR)-1,1-dicyano-2-(3,4-dimethoxyphenyl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-3-carboxamide (PubChem CID 7524407) has the molecular formula C23H21N4O3+ and a molecular weight of 401.45 g/mol. Its IUPAC name is (2S,3S,10bR)-1,1-dicyano-2-(3,4-dimethoxyphenyl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-3-carboxamide.
| Compound Name | (2S,3S,10bR)-1,1-dicyano-2-(3,4-dimethoxyphenyl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-3-carboxamide |
|---|---|
| PubChem CID | 7524407 |
| Molecular Formula | C23H21N4O3+ |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (2S,3S,10bR)-1,1-dicyano-2-(3,4-dimethoxyphenyl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-3-carboxamide |
| SMILES | COc1ccc([C@@H]2[C@@H](C(N)=O)[NH+]3C=Cc4ccccc4[C@@H]3C2(C#N)C#N)cc1OC |
| InChI | InChI=1S/C23H20N4O3/c1-29-17-8-7-15(11-18(17)30-2)19-20(22(26)28)27-10-9-14-5-3-4-6-16(14)21(27)23(19,12-24)13-25/h3-11,19-21H,1-2H3,(H2,26,28)/p+1/t19-,20+,21-/m1/s1 |
| InChIKey | PIHDTVDPNVAXPG-QHAWAJNXSA-O |
| XLogP | 1.30 |
| TPSA | 113.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |