C9H10BrN3O2S — CID 752986
4-bromo-1-methyl-N-[(3R)-2-oxothiolan-3-yl]pyrazole-5-carboxamide (PubChem CID 752986) has the molecular formula C9H10BrN3O2S and a molecular weight of 304.17 g/mol. Its IUPAC name is 4-bromo-1-methyl-N-[(3R)-2-oxothiolan-3-yl]pyrazole-5-carboxamide.
| Compound Name | 4-bromo-1-methyl-N-[(3R)-2-oxothiolan-3-yl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 752986 |
| Molecular Formula | C9H10BrN3O2S |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 4-bromo-1-methyl-N-[(3R)-2-oxothiolan-3-yl]pyrazole-5-carboxamide |
| SMILES | Cn1ncc(Br)c1C(=O)N[C@@H]1CCSC1=O |
| InChI | InChI=1S/C9H10BrN3O2S/c1-13-7(5(10)4-11-13)8(14)12-6-2-3-16-9(6)15/h4,6H,2-3H2,1H3,(H,12,14)/t6-/m1/s1 |
| InChIKey | HWQCZVWUOSMNFE-ZCFIWIBFSA-N |
| XLogP | 0.94 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|