C21H22N4O4S — CID 75373447
1-(3-acetylphenyl)sulfonyl-N-imidazo[1,2-a]pyridin-5-ylpiperidine-4-carboxamide (PubChem CID 75373447) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is 1-(3-acetylphenyl)sulfonyl-N-imidazo[1,2-a]pyridin-5-ylpiperidine-4-carboxamide.
| Compound Name | 1-(3-acetylphenyl)sulfonyl-N-imidazo[1,2-a]pyridin-5-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 75373447 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 1-(3-acetylphenyl)sulfonyl-N-imidazo[1,2-a]pyridin-5-ylpiperidine-4-carboxamide |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N2CCC(C(=O)Nc3cccc4nccn34)CC2)c1 |
| InChI | InChI=1S/C21H22N4O4S/c1-15(26)17-4-2-5-18(14-17)30(28,29)24-11-8-16(9-12-24)21(27)23-20-7-3-6-19-22-10-13-25(19)20/h2-7,10,13-14,16H,8-9,11-12H2,1H3,(H,23,27) |
| InChIKey | YEJCQJSXJODBHX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |