C12H9BrN2O2S — CID 75416245
5-bromo-N-(3-cyano-5-ethylthiophen-2-yl)furan-3-carboxamide (PubChem CID 75416245) has the molecular formula C12H9BrN2O2S and a molecular weight of 325.19 g/mol. Its IUPAC name is 5-bromo-N-(3-cyano-5-ethylthiophen-2-yl)furan-3-carboxamide.
| Compound Name | 5-bromo-N-(3-cyano-5-ethylthiophen-2-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 75416245 |
| Molecular Formula | C12H9BrN2O2S |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | 5-bromo-N-(3-cyano-5-ethylthiophen-2-yl)furan-3-carboxamide |
| SMILES | CCc1cc(C#N)c(NC(=O)c2coc(Br)c2)s1 |
| InChI | InChI=1S/C12H9BrN2O2S/c1-2-9-3-7(5-14)12(18-9)15-11(16)8-4-10(13)17-6-8/h3-4,6H,2H2,1H3,(H,15,16) |
| InChIKey | QRECIEZSTWCOSY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |