C21H33N3O3S — CID 75430677
tert-butyl N-[1-[(E)-3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoyl]-2-methylpiperidin-4-yl]carbamate (PubChem CID 75430677) has the molecular formula C21H33N3O3S and a molecular weight of 407.58 g/mol. Its IUPAC name is tert-butyl N-[1-[(E)-3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoyl]-2-methylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(E)-3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoyl]-2-methylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 75430677 |
| Molecular Formula | C21H33N3O3S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | tert-butyl N-[1-[(E)-3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoyl]-2-methylpiperidin-4-yl]carbamate |
| SMILES | CC1CC(NC(=O)OC(C)(C)C)CCN1C(=O)/C=C/c1cnc(C(C)(C)C)s1 |
| InChI | InChI=1S/C21H33N3O3S/c1-14-12-15(23-19(26)27-21(5,6)7)10-11-24(14)17(25)9-8-16-13-22-18(28-16)20(2,3)4/h8-9,13-15H,10-12H2,1-7H3,(H,23,26)/b9-8+ |
| InChIKey | AJPPCIGNHNHPOD-CMDGGOBGSA-N |
| XLogP | 4.36 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|