C10H14F2N2O2 — CID 75450414
3-(difluoromethoxy)-N-(3-methoxypropyl)pyridin-2-amine (PubChem CID 75450414) has the molecular formula C10H14F2N2O2 and a molecular weight of 232.23 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-(3-methoxypropyl)pyridin-2-amine.
| Compound Name | 3-(difluoromethoxy)-N-(3-methoxypropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 75450414 |
| Molecular Formula | C10H14F2N2O2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 3-(difluoromethoxy)-N-(3-methoxypropyl)pyridin-2-amine |
| SMILES | COCCCNc1ncccc1OC(F)F |
| InChI | InChI=1S/C10H14F2N2O2/c1-15-7-3-6-14-9-8(16-10(11)12)4-2-5-13-9/h2,4-5,10H,3,6-7H2,1H3,(H,13,14) |
| InChIKey | AFRIINCKGMQNQY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|