C8H7BClNO2S2 — CID 75485857
(6-chloro-2-methylsulfanyl-1,3-benzothiazol-4-yl)boronic acid (PubChem CID 75485857) has the molecular formula C8H7BClNO2S2 and a molecular weight of 259.55 g/mol. Its IUPAC name is (6-chloro-2-methylsulfanyl-1,3-benzothiazol-4-yl)boronic acid.
| Compound Name | (6-chloro-2-methylsulfanyl-1,3-benzothiazol-4-yl)boronic acid |
|---|---|
| PubChem CID | 75485857 |
| Molecular Formula | C8H7BClNO2S2 |
| Molecular Weight | 259.55 g/mol |
| Exact Mass | 258.97 |
| IUPAC Name | (6-chloro-2-methylsulfanyl-1,3-benzothiazol-4-yl)boronic acid |
| SMILES | CSc1nc2c(B(O)O)cc(Cl)cc2s1 |
| InChI | InChI=1S/C8H7BClNO2S2/c1-14-8-11-7-5(9(12)13)2-4(10)3-6(7)15-8/h2-3,12-13H,1H3 |
| InChIKey | USUBVLOYOXIEQW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.55 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|