C19H29FN4O — CID 75496457
4-benzyl-N-ethyl-N'-(3-fluoropropyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carboximidamide (PubChem CID 75496457) has the molecular formula C19H29FN4O and a molecular weight of 348.47 g/mol. Its IUPAC name is 4-benzyl-N-ethyl-N'-(3-fluoropropyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carboximidamide.
| Compound Name | 4-benzyl-N-ethyl-N'-(3-fluoropropyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carboximidamide |
|---|---|
| PubChem CID | 75496457 |
| Molecular Formula | C19H29FN4O |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 4-benzyl-N-ethyl-N'-(3-fluoropropyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carboximidamide |
| SMILES | CCN/C(=N\CCCF)N1CC2OCCN(Cc3ccccc3)C2C1 |
| InChI | InChI=1S/C19H29FN4O/c1-2-21-19(22-10-6-9-20)24-14-17-18(15-24)25-12-11-23(17)13-16-7-4-3-5-8-16/h3-5,7-8,17-18H,2,6,9-15H2,1H3,(H,21,22) |
| InChIKey | BUGYEXFMXAUHDU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|