C16H28N5O4+ — CID 75608949
7-[3-(tert-butylamino)-2-hydroxypropyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 75608949) has the molecular formula C16H28N5O4+ and a molecular weight of 354.43 g/mol. Its IUPAC name is 7-[3-(tert-butylamino)-2-hydroxypropyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[3-(tert-butylamino)-2-hydroxypropyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 75608949 |
| Molecular Formula | C16H28N5O4+ |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 7-[3-(tert-butylamino)-2-hydroxypropyl]-8-(methoxymethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | COCC1=[N+](CC(O)CNC(C)(C)C)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C16H28N5O4/c1-16(2,3)17-7-10(22)8-21-11(9-25-6)18-13-12(21)14(23)20(5)15(24)19(13)4/h10,12,17,22H,7-9H2,1-6H3/q+1 |
| InChIKey | ZANXLUSPZJMNGN-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|