C21H30O3 — CID 75986837
1,1,4a,10b-tetramethyl-2,3,4,4b,5,11,12,12a-octahydronaphtho[1,2-c]chromene-7,9-diol (PubChem CID 75986837) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is 1,1,4a,10b-tetramethyl-2,3,4,4b,5,11,12,12a-octahydronaphtho[1,2-c]chromene-7,9-diol.
| Compound Name | 1,1,4a,10b-tetramethyl-2,3,4,4b,5,11,12,12a-octahydronaphtho[1,2-c]chromene-7,9-diol |
|---|---|
| PubChem CID | 75986837 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 1,1,4a,10b-tetramethyl-2,3,4,4b,5,11,12,12a-octahydronaphtho[1,2-c]chromene-7,9-diol |
| SMILES | CC1(C)CCCC2(C)C1CCC1(C)c3cc(O)cc(O)c3OCC12 |
| InChI | InChI=1S/C21H30O3/c1-19(2)7-5-8-21(4)16(19)6-9-20(3)14-10-13(22)11-15(23)18(14)24-12-17(20)21/h10-11,16-17,22-23H,5-9,12H2,1-4H3 |
| InChIKey | RALBXBRUDNAEKJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |