C16H19N3O5S — CID 7632441
[(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate (PubChem CID 7632441) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate.
| Compound Name | [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
|---|---|
| PubChem CID | 7632441 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | [(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
| SMILES | CCNC(=O)NC(=O)[C@@H](OC(=O)CN1CCSC1=O)c1ccccc1 |
| InChI | InChI=1S/C16H19N3O5S/c1-2-17-15(22)18-14(21)13(11-6-4-3-5-7-11)24-12(20)10-19-8-9-25-16(19)23/h3-7,13H,2,8-10H2,1H3,(H2,17,18,21,22)/t13-/m0/s1 |
| InChIKey | MTNNKHJKFJLLPP-ZDUSSCGKSA-N |
| XLogP | 1.29 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|