C22H14N2S2 — CID 76573377
3-isocyano-2,3-bis(2-methyl-1-benzothiophen-3-yl)prop-2-enenitrile (PubChem CID 76573377) has the molecular formula C22H14N2S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 3-isocyano-2,3-bis(2-methyl-1-benzothiophen-3-yl)prop-2-enenitrile.
| Compound Name | 3-isocyano-2,3-bis(2-methyl-1-benzothiophen-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 76573377 |
| Molecular Formula | C22H14N2S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 3-isocyano-2,3-bis(2-methyl-1-benzothiophen-3-yl)prop-2-enenitrile |
| SMILES | [C-]#[N+]C(=C(C#N)c1c(C)sc2ccccc12)c1c(C)sc2ccccc12 |
| InChI | InChI=1S/C22H14N2S2/c1-13-20(15-8-4-6-10-18(15)25-13)17(12-23)22(24-3)21-14(2)26-19-11-7-5-9-16(19)21/h4-11H,1-2H3 |
| InChIKey | NFVUSTOTJDSLII-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|