C28H36N2O3 — CID 76617244
tert-butyl 2-[7-[3-(4-tert-butylphenyl)prop-2-enoylamino]-3,4-dihydro-1H-isoquinolin-2-yl]acetate (PubChem CID 76617244) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is tert-butyl 2-[7-[3-(4-tert-butylphenyl)prop-2-enoylamino]-3,4-dihydro-1H-isoquinolin-2-yl]acetate.
| Compound Name | tert-butyl 2-[7-[3-(4-tert-butylphenyl)prop-2-enoylamino]-3,4-dihydro-1H-isoquinolin-2-yl]acetate |
|---|---|
| PubChem CID | 76617244 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | tert-butyl 2-[7-[3-(4-tert-butylphenyl)prop-2-enoylamino]-3,4-dihydro-1H-isoquinolin-2-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCc2ccc(NC(=O)C=Cc3ccc(C(C)(C)C)cc3)cc2C1 |
| InChI | InChI=1S/C28H36N2O3/c1-27(2,3)23-11-7-20(8-12-23)9-14-25(31)29-24-13-10-21-15-16-30(18-22(21)17-24)19-26(32)33-28(4,5)6/h7-14,17H,15-16,18-19H2,1-6H3,(H,29,31) |
| InChIKey | OEDOOROYOSHKOH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|