C19H35NO4 — CID 76638058
8-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)methoxy]-4-methyloct-2-enoic acid (PubChem CID 76638058) has the molecular formula C19H35NO4 and a molecular weight of 341.49 g/mol. Its IUPAC name is 8-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)methoxy]-4-methyloct-2-enoic acid.
| Compound Name | 8-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)methoxy]-4-methyloct-2-enoic acid |
|---|---|
| PubChem CID | 76638058 |
| Molecular Formula | C19H35NO4 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | 8-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)methoxy]-4-methyloct-2-enoic acid |
| SMILES | CC(C=CC(=O)O)CCCCOCC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C19H35NO4/c1-15(9-10-17(21)22)8-6-7-11-24-14-16-12-18(2,3)20(23)19(4,5)13-16/h9-10,15-16,23H,6-8,11-14H2,1-5H3,(H,21,22) |
| InChIKey | YRAZEGCGOFDADK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|