C34H38N2O7 — CID 76736840
methyl 4-[[[4-[hydroperoxy-[4-(6-prop-2-enoyloxyhexoxy)phenyl]methyl]-3,5-dimethylphenyl]methylidenehydrazinylidene]methyl]benzoate (PubChem CID 76736840) has the molecular formula C34H38N2O7 and a molecular weight of 586.69 g/mol. Its IUPAC name is methyl 4-[[[4-[hydroperoxy-[4-(6-prop-2-enoyloxyhexoxy)phenyl]methyl]-3,5-dimethylphenyl]methylidenehydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[[[4-[hydroperoxy-[4-(6-prop-2-enoyloxyhexoxy)phenyl]methyl]-3,5-dimethylphenyl]methylidenehydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 76736840 |
| Molecular Formula | C34H38N2O7 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | methyl 4-[[[4-[hydroperoxy-[4-(6-prop-2-enoyloxyhexoxy)phenyl]methyl]-3,5-dimethylphenyl]methylidenehydrazinylidene]methyl]benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(OO)c2c(C)cc(C=NN=Cc3ccc(C(=O)OC)cc3)cc2C)cc1 |
| InChI | InChI=1S/C34H38N2O7/c1-5-31(37)42-19-9-7-6-8-18-41-30-16-14-28(15-17-30)33(43-39)32-24(2)20-27(21-25(32)3)23-36-35-22-26-10-12-29(13-11-26)34(38)40-4/h5,10-17,20-23,33,39H,1,6-9,18-19H2,2-4H3 |
| InChIKey | OPIAWWWUTDFLQZ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|