C27H44O8 — CID 76759985
2-(1-acetyloxypropyl)-3-butoxycarbonyl-5-methyl-6-oxo-6-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]hexanoic acid (PubChem CID 76759985) has the molecular formula C27H44O8 and a molecular weight of 496.64 g/mol. Its IUPAC name is 2-(1-acetyloxypropyl)-3-butoxycarbonyl-5-methyl-6-oxo-6-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]hexanoic acid.
| Compound Name | 2-(1-acetyloxypropyl)-3-butoxycarbonyl-5-methyl-6-oxo-6-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]hexanoic acid |
|---|---|
| PubChem CID | 76759985 |
| Molecular Formula | C27H44O8 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | 2-(1-acetyloxypropyl)-3-butoxycarbonyl-5-methyl-6-oxo-6-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]hexanoic acid |
| SMILES | CCCCOC(=O)C(CC(C)C(=O)OC1CC2CCC1(C)C2(C)C)C(C(=O)O)C(CC)OC(C)=O |
| InChI | InChI=1S/C27H44O8/c1-8-10-13-33-25(32)19(22(23(29)30)20(9-2)34-17(4)28)14-16(3)24(31)35-21-15-18-11-12-27(21,7)26(18,5)6/h16,18-22H,8-15H2,1-7H3,(H,29,30) |
| InChIKey | MQCABSSXIGVHCL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|