C12H16O4 — CID 76764274
(8R)-8-ethoxy-3,8-dimethyl-2,5-dihydrofuro[3,4-b]oxepin-6-one (PubChem CID 76764274) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (8R)-8-ethoxy-3,8-dimethyl-2,5-dihydrofuro[3,4-b]oxepin-6-one.
| Compound Name | (8R)-8-ethoxy-3,8-dimethyl-2,5-dihydrofuro[3,4-b]oxepin-6-one |
|---|---|
| PubChem CID | 76764274 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (8R)-8-ethoxy-3,8-dimethyl-2,5-dihydrofuro[3,4-b]oxepin-6-one |
| SMILES | CCO[C@]1(C)OC(=O)C2=C1OCC(C)=CC2 |
| InChI | InChI=1S/C12H16O4/c1-4-15-12(3)10-9(11(13)16-12)6-5-8(2)7-14-10/h5H,4,6-7H2,1-3H3/t12-/m1/s1 |
| InChIKey | SNBSCLWHSJINSG-GFCCVEGCSA-N |
| XLogP | 1.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|