C23H20N4S — CID 76797321
4-[[2-(diisocyanomethylidene)-4-phenyl-1,3-thiazol-5-ylidene]methyl]-N,N-diethylaniline (PubChem CID 76797321) has the molecular formula C23H20N4S and a molecular weight of 384.51 g/mol. Its IUPAC name is 4-[[2-(diisocyanomethylidene)-4-phenyl-1,3-thiazol-5-ylidene]methyl]-N,N-diethylaniline.
| Compound Name | 4-[[2-(diisocyanomethylidene)-4-phenyl-1,3-thiazol-5-ylidene]methyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 76797321 |
| Molecular Formula | C23H20N4S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-[[2-(diisocyanomethylidene)-4-phenyl-1,3-thiazol-5-ylidene]methyl]-N,N-diethylaniline |
| SMILES | [C-]#[N+]C([N+]#[C-])=c1nc(-c2ccccc2)c(=Cc2ccc(N(CC)CC)cc2)s1 |
| InChI | InChI=1S/C23H20N4S/c1-5-27(6-2)19-14-12-17(13-15-19)16-20-21(18-10-8-7-9-11-18)26-23(28-20)22(24-3)25-4/h7-16H,5-6H2,1-2H3 |
| InChIKey | KUUCYFAUHAKDMD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 24.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|