About 2-(dimethylamino)ethenol
2-(dimethylamino)ethenol (PubChem CID 76835674) has the molecular formula C4H9NO
and a molecular weight of 87.12 g/mol. Its IUPAC name is 2-(dimethylamino)ethenol.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethenol |
| PubChem CID | 76835674 |
| Molecular Formula | C4H9NO |
| Molecular Weight | 87.12 g/mol |
| Exact Mass | 87.07 |
| IUPAC Name | 2-(dimethylamino)ethenol |
| SMILES | CN(C)C=CO |
| InChI | InChI=1S/C4H9NO/c1-5(2)3-4-6/h3-4,6H,1-2H3 |
| InChIKey | JXZUDCIMRVGZHD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.12 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethenol?
The IUPAC name of 2-(dimethylamino)ethenol (CID 76835674) is 2-(dimethylamino)ethenol.
What is the SMILES notation for 2-(dimethylamino)ethenol?
The canonical SMILES for 2-(dimethylamino)ethenol is CN(C)C=CO.
What is the InChIKey of 2-(dimethylamino)ethenol?
The InChIKey is JXZUDCIMRVGZHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO/c1-5(2)3-4-6/h3-4,6H,1-2H3.
What are the key properties of 2-(dimethylamino)ethenol?
2-(dimethylamino)ethenol has a molecular weight of 87.12 g/mol, XLogP of 0.58, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethenol is sourced from PubChem (CID 76835674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).