C10H21ClN2 — CID 77051248
N'-(4-chlorobut-2-enyl)-N,N,N'-trimethylpropane-1,3-diamine (PubChem CID 77051248) has the molecular formula C10H21ClN2 and a molecular weight of 204.75 g/mol. Its IUPAC name is N'-(4-chlorobut-2-enyl)-N,N,N'-trimethylpropane-1,3-diamine.
| Compound Name | N'-(4-chlorobut-2-enyl)-N,N,N'-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 77051248 |
| Molecular Formula | C10H21ClN2 |
| Molecular Weight | 204.75 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | N'-(4-chlorobut-2-enyl)-N,N,N'-trimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCN(C)CC=CCCl |
| InChI | InChI=1S/C10H21ClN2/c1-12(2)8-6-10-13(3)9-5-4-7-11/h4-5H,6-10H2,1-3H3 |
| InChIKey | JSJMJMNEXWHMII-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.75 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|