C10H18N4O3 — CID 77109780
3-[(2,6-dioxopiperidin-3-yl)amino]-N'-hydroxypentanimidamide (PubChem CID 77109780) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is 3-[(2,6-dioxopiperidin-3-yl)amino]-N'-hydroxypentanimidamide.
| Compound Name | 3-[(2,6-dioxopiperidin-3-yl)amino]-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 77109780 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 3-[(2,6-dioxopiperidin-3-yl)amino]-N'-hydroxypentanimidamide |
| SMILES | CCC(CC(N)=NO)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C10H18N4O3/c1-2-6(5-8(11)14-17)12-7-3-4-9(15)13-10(7)16/h6-7,12,17H,2-5H2,1H3,(H2,11,14)(H,13,15,16) |
| InChIKey | QOEKIQCHAWDVGW-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|