C18H32N4O3 — CID 166865172
3-[[4-[[(1S,2S)-2-aminocyclohexyl]-methylamino]-1-hydroxy-2-methylidenepentyl]amino]piperidine-2,6-dione (PubChem CID 166865172) has the molecular formula C18H32N4O3 and a molecular weight of 352.48 g/mol. Its IUPAC name is 3-[[4-[[(1S,2S)-2-aminocyclohexyl]-methylamino]-1-hydroxy-2-methylidenepentyl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[4-[[(1S,2S)-2-aminocyclohexyl]-methylamino]-1-hydroxy-2-methylidenepentyl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166865172 |
| Molecular Formula | C18H32N4O3 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 3-[[4-[[(1S,2S)-2-aminocyclohexyl]-methylamino]-1-hydroxy-2-methylidenepentyl]amino]piperidine-2,6-dione |
| SMILES | C=C(CC(C)N(C)[C@H]1CCCC[C@@H]1N)C(O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H32N4O3/c1-11(17(24)20-14-8-9-16(23)21-18(14)25)10-12(2)22(3)15-7-5-4-6-13(15)19/h12-15,17,20,24H,1,4-10,19H2,2-3H3,(H,21,23,25)/t12?,13-,14?,15-,17?/m0/s1 |
| InChIKey | IZDYYKMBMWDMLO-ZJVBCEJDSA-N |
| XLogP | 0.24 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|