C18H31N3O4 — CID 166875895
3-[[3-[(1S,2S)-2-aminocyclopentyl]oxy-4-methoxy-3-methyl-2-methylidenepentyl]amino]piperidine-2,6-dione (PubChem CID 166875895) has the molecular formula C18H31N3O4 and a molecular weight of 353.46 g/mol. Its IUPAC name is 3-[[3-[(1S,2S)-2-aminocyclopentyl]oxy-4-methoxy-3-methyl-2-methylidenepentyl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[3-[(1S,2S)-2-aminocyclopentyl]oxy-4-methoxy-3-methyl-2-methylidenepentyl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166875895 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | 3-[[3-[(1S,2S)-2-aminocyclopentyl]oxy-4-methoxy-3-methyl-2-methylidenepentyl]amino]piperidine-2,6-dione |
| SMILES | C=C(CNC1CCC(=O)NC1=O)C(C)(O[C@H]1CCC[C@@H]1N)C(C)OC |
| InChI | InChI=1S/C18H31N3O4/c1-11(10-20-14-8-9-16(22)21-17(14)23)18(3,12(2)24-4)25-15-7-5-6-13(15)19/h12-15,20H,1,5-10,19H2,2-4H3,(H,21,22,23)/t12?,13-,14?,15-,18?/m0/s1 |
| InChIKey | DULQDTRCZAHMAO-SUFGCDPTSA-N |
| XLogP | 0.63 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|