C27H31FN8OSSi — CID 77172276
2-[3-[2-fluoro-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]thiophene-3,4-dicarbonitrile (PubChem CID 77172276) has the molecular formula C27H31FN8OSSi and a molecular weight of 562.75 g/mol. Its IUPAC name is 2-[3-[2-fluoro-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]thiophene-3,4-dicarbonitrile.
| Compound Name | 2-[3-[2-fluoro-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]thiophene-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 77172276 |
| Molecular Formula | C27H31FN8OSSi |
| Molecular Weight | 562.75 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 2-[3-[2-fluoro-1-[4-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrazol-1-yl]ethyl]pyrrolidin-1-yl]thiophene-3,4-dicarbonitrile |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(-c3cnn(C(CF)C4CCN(c5scc(C#N)c5C#N)C4)c3)ncnc21 |
| InChI | InChI=1S/C27H31FN8OSSi/c1-39(2,3)9-8-37-18-35-7-5-22-25(31-17-32-26(22)35)21-13-33-36(15-21)24(10-28)19-4-6-34(14-19)27-23(12-30)20(11-29)16-38-27/h5,7,13,15-17,19,24H,4,6,8-10,14,18H2,1-3H3 |
| InChIKey | JNLOOCJECYFLQA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 108.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.75 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|