C23H30N3O2S+ — CID 7734131
(2S)-3-(3,4-dimethylphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate (PubChem CID 7734131) has the molecular formula C23H30N3O2S+ and a molecular weight of 412.58 g/mol. Its IUPAC name is (2S)-3-(3,4-dimethylphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate.
| Compound Name | (2S)-3-(3,4-dimethylphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate |
|---|---|
| PubChem CID | 7734131 |
| Molecular Formula | C23H30N3O2S+ |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (2S)-3-(3,4-dimethylphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)-3-oxo-2-pyridin-1-ium-1-ylpropanimidothioate |
| SMILES | Cc1ccc(C(=O)[C@@H](/C([S-])=N/CCC[NH+]2CCOCC2)[n+]2ccccc2)cc1C |
| InChI | InChI=1S/C23H29N3O2S/c1-18-7-8-20(17-19(18)2)22(27)21(26-11-4-3-5-12-26)23(29)24-9-6-10-25-13-15-28-16-14-25/h3-5,7-8,11-12,17,21H,6,9-10,13-16H2,1-2H3/p+1/t21-/m0/s1 |
| InChIKey | PUSOZRRQLGTDHX-NRFANRHFSA-O |
| XLogP | 1.27 |
| TPSA | 46.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|