C27H37N7O4 — CID 77392716
5-[6-(6-aminopurin-9-yl)-7-hydroxy-2-methyl-2,4,4a,6,7,7a-hexahydrofuro[2,3-e][1,3]oxazin-3-yl]-N-(4-tert-butylphenyl)pentanamide (PubChem CID 77392716) has the molecular formula C27H37N7O4 and a molecular weight of 523.64 g/mol. Its IUPAC name is 5-[6-(6-aminopurin-9-yl)-7-hydroxy-2-methyl-2,4,4a,6,7,7a-hexahydrofuro[2,3-e][1,3]oxazin-3-yl]-N-(4-tert-butylphenyl)pentanamide.
| Compound Name | 5-[6-(6-aminopurin-9-yl)-7-hydroxy-2-methyl-2,4,4a,6,7,7a-hexahydrofuro[2,3-e][1,3]oxazin-3-yl]-N-(4-tert-butylphenyl)pentanamide |
|---|---|
| PubChem CID | 77392716 |
| Molecular Formula | C27H37N7O4 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | 5-[6-(6-aminopurin-9-yl)-7-hydroxy-2-methyl-2,4,4a,6,7,7a-hexahydrofuro[2,3-e][1,3]oxazin-3-yl]-N-(4-tert-butylphenyl)pentanamide |
| SMILES | CC1OC2C(CN1CCCCC(=O)Nc1ccc(C(C)(C)C)cc1)OC(n1cnc3c(N)ncnc31)C2O |
| InChI | InChI=1S/C27H37N7O4/c1-16-33(12-6-5-7-20(35)32-18-10-8-17(9-11-18)27(2,3)4)13-19-23(37-16)22(36)26(38-19)34-15-31-21-24(28)29-14-30-25(21)34/h8-11,14-16,19,22-23,26,36H,5-7,12-13H2,1-4H3,(H,32,35)(H2,28,29,30) |
| InChIKey | CDUGUZLXFJVEDE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|