C16H19NO3S — CID 774561
ethyl 3-ethylsulfanyl-1-oxo-5,6,7,8-tetrahydropyrrolo[1,2-a]indole-2-carboxylate (PubChem CID 774561) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is ethyl 3-ethylsulfanyl-1-oxo-5,6,7,8-tetrahydropyrrolo[1,2-a]indole-2-carboxylate.
| Compound Name | ethyl 3-ethylsulfanyl-1-oxo-5,6,7,8-tetrahydropyrrolo[1,2-a]indole-2-carboxylate |
|---|---|
| PubChem CID | 774561 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | ethyl 3-ethylsulfanyl-1-oxo-5,6,7,8-tetrahydropyrrolo[1,2-a]indole-2-carboxylate |
| SMILES | CCOC(=O)C1=C(SCC)c2cc3c(n2C1=O)CCCC3 |
| InChI | InChI=1S/C16H19NO3S/c1-3-20-16(19)13-14(21-4-2)12-9-10-7-5-6-8-11(10)17(12)15(13)18/h9H,3-8H2,1-2H3 |
| InChIKey | CPSOMWZCOOZHJZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|