C20H19NO5S — CID 77469875
1-[2-methyl-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-2,1-benzothiazol-3-one (PubChem CID 77469875) has the molecular formula C20H19NO5S and a molecular weight of 385.44 g/mol. Its IUPAC name is 1-[2-methyl-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-2,1-benzothiazol-3-one.
| Compound Name | 1-[2-methyl-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-2,1-benzothiazol-3-one |
|---|---|
| PubChem CID | 77469875 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 1-[2-methyl-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-2,1-benzothiazol-3-one |
| SMILES | COc1cc(C=C(C)C(=O)n2sc(=O)c3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C20H19NO5S/c1-12(9-13-10-16(24-2)18(26-4)17(11-13)25-3)19(22)21-15-8-6-5-7-14(15)20(23)27-21/h5-11H,1-4H3 |
| InChIKey | BJOXNMJTCCNSIU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|