C18H20ClNO5 — CID 175989360
5-chloro-1-[2-methyl-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one (PubChem CID 175989360) has the molecular formula C18H20ClNO5 and a molecular weight of 365.81 g/mol. Its IUPAC name is 5-chloro-1-[2-methyl-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one.
| Compound Name | 5-chloro-1-[2-methyl-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 175989360 |
| Molecular Formula | C18H20ClNO5 |
| Molecular Weight | 365.81 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 5-chloro-1-[2-methyl-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one |
| SMILES | COc1cc(C=C(C)C(=O)N2CCC=C(Cl)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C18H20ClNO5/c1-11(17(21)20-7-5-6-13(19)18(20)22)8-12-9-14(23-2)16(25-4)15(10-12)24-3/h6,8-10H,5,7H2,1-4H3 |
| InChIKey | WDEMTNBDARYAIM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.81 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|