C18H33NO2 — CID 78044120
1-ethyl-7-methoxy-3,5-dimethyl-1-azacyclotetradeca-3,8-dien-6-ol (PubChem CID 78044120) has the molecular formula C18H33NO2 and a molecular weight of 295.47 g/mol. Its IUPAC name is 1-ethyl-7-methoxy-3,5-dimethyl-1-azacyclotetradeca-3,8-dien-6-ol.
| Compound Name | 1-ethyl-7-methoxy-3,5-dimethyl-1-azacyclotetradeca-3,8-dien-6-ol |
|---|---|
| PubChem CID | 78044120 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | 1-ethyl-7-methoxy-3,5-dimethyl-1-azacyclotetradeca-3,8-dien-6-ol |
| SMILES | CCN1CCCCCC=CC(OC)C(O)C(C)C=C(C)C1 |
| InChI | InChI=1S/C18H33NO2/c1-5-19-12-10-8-6-7-9-11-17(21-4)18(20)16(3)13-15(2)14-19/h9,11,13,16-18,20H,5-8,10,12,14H2,1-4H3 |
| InChIKey | FBGOFIYMLLJFLU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|