C17H31NO2 — CID 78044140
7-methoxy-1,3,5-trimethyl-1-azacyclotetradeca-3,8-dien-6-ol (PubChem CID 78044140) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 7-methoxy-1,3,5-trimethyl-1-azacyclotetradeca-3,8-dien-6-ol.
| Compound Name | 7-methoxy-1,3,5-trimethyl-1-azacyclotetradeca-3,8-dien-6-ol |
|---|---|
| PubChem CID | 78044140 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | 7-methoxy-1,3,5-trimethyl-1-azacyclotetradeca-3,8-dien-6-ol |
| SMILES | COC1C=CCCCCCN(C)CC(C)=CC(C)C1O |
| InChI | InChI=1S/C17H31NO2/c1-14-12-15(2)17(19)16(20-4)10-8-6-5-7-9-11-18(3)13-14/h8,10,12,15-17,19H,5-7,9,11,13H2,1-4H3 |
| InChIKey | RHZVDWVURCGKLO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|