C19H23BrO6S — CID 78142793
1-[(3,4-dimethoxyphenyl)methoxy]butan-2-yl 4-bromobenzenesulfonate (PubChem CID 78142793) has the molecular formula C19H23BrO6S and a molecular weight of 459.36 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methoxy]butan-2-yl 4-bromobenzenesulfonate.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methoxy]butan-2-yl 4-bromobenzenesulfonate |
|---|---|
| PubChem CID | 78142793 |
| Molecular Formula | C19H23BrO6S |
| Molecular Weight | 459.36 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methoxy]butan-2-yl 4-bromobenzenesulfonate |
| SMILES | CCC(COCc1ccc(OC)c(OC)c1)OS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H23BrO6S/c1-4-16(26-27(21,22)17-8-6-15(20)7-9-17)13-25-12-14-5-10-18(23-2)19(11-14)24-3/h5-11,16H,4,12-13H2,1-3H3 |
| InChIKey | GOEWLTPHDYWOPL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|