C11H17N5O2 — CID 78204406
8-(dimethylamino)-3-methyl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione (PubChem CID 78204406) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 8-(dimethylamino)-3-methyl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-(dimethylamino)-3-methyl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78204406 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 8-(dimethylamino)-3-methyl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione |
| SMILES | C=CCN1C(N(C)C)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C11H17N5O2/c1-5-6-16-7-8(12-10(16)14(2)3)15(4)11(18)13-9(7)17/h5,7-8H,1,6H2,2-4H3,(H,13,17,18) |
| InChIKey | TUHXDRTZXNBBAN-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|