C8H8ClN4O2+ — CID 78207303
6-chloro-1,3-dimethyl-4aH-pteridin-1-ium-2,4-dione (PubChem CID 78207303) has the molecular formula C8H8ClN4O2+ and a molecular weight of 227.63 g/mol. Its IUPAC name is 6-chloro-1,3-dimethyl-4aH-pteridin-1-ium-2,4-dione.
| Compound Name | 6-chloro-1,3-dimethyl-4aH-pteridin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 78207303 |
| Molecular Formula | C8H8ClN4O2+ |
| Molecular Weight | 227.63 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 6-chloro-1,3-dimethyl-4aH-pteridin-1-ium-2,4-dione |
| SMILES | CN1C(=O)C2N=C(Cl)C=NC2=[N+](C)C1=O |
| InChI | InChI=1S/C8H8ClN4O2/c1-12-6-5(11-4(9)3-10-6)7(14)13(2)8(12)15/h3,5H,1-2H3/q+1 |
| InChIKey | COQORPGFTIAWFA-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 65.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.63 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|