C11H15N4O2+ — CID 78207139
1,3-dimethyl-6-propyl-4aH-pteridin-1-ium-2,4-dione (PubChem CID 78207139) has the molecular formula C11H15N4O2+ and a molecular weight of 235.27 g/mol. Its IUPAC name is 1,3-dimethyl-6-propyl-4aH-pteridin-1-ium-2,4-dione.
| Compound Name | 1,3-dimethyl-6-propyl-4aH-pteridin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 78207139 |
| Molecular Formula | C11H15N4O2+ |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1,3-dimethyl-6-propyl-4aH-pteridin-1-ium-2,4-dione |
| SMILES | CCCC1=NC2C(=O)N(C)C(=O)[N+](C)=C2N=C1 |
| InChI | InChI=1S/C11H15N4O2/c1-4-5-7-6-12-9-8(13-7)10(16)15(3)11(17)14(9)2/h6,8H,4-5H2,1-3H3/q+1 |
| InChIKey | UDGPEFMIBIGOGK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 65.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|