C10H14N5O2+ — CID 78208136
8-[(dimethylamino)methyl]-1,3-dimethylpurin-3-ium-2,6-dione (PubChem CID 78208136) has the molecular formula C10H14N5O2+ and a molecular weight of 236.25 g/mol. Its IUPAC name is 8-[(dimethylamino)methyl]-1,3-dimethylpurin-3-ium-2,6-dione.
| Compound Name | 8-[(dimethylamino)methyl]-1,3-dimethylpurin-3-ium-2,6-dione |
|---|---|
| PubChem CID | 78208136 |
| Molecular Formula | C10H14N5O2+ |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 8-[(dimethylamino)methyl]-1,3-dimethylpurin-3-ium-2,6-dione |
| SMILES | CN(C)CC1=NC2=[N+](C)C(=O)N(C)C(=O)C2=N1 |
| InChI | InChI=1S/C10H14N5O2/c1-13(2)5-6-11-7-8(12-6)14(3)10(17)15(4)9(7)16/h5H2,1-4H3/q+1 |
| InChIKey | AMUPGPOFKFZRKA-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 68.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|