C7H6N4O2 — CID 23422139
3-methyl-4aH-pteridine-2,4-dione (PubChem CID 23422139) has the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. Its IUPAC name is 3-methyl-4aH-pteridine-2,4-dione.
| Compound Name | 3-methyl-4aH-pteridine-2,4-dione |
|---|---|
| PubChem CID | 23422139 |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 3-methyl-4aH-pteridine-2,4-dione |
| SMILES | CN1C(=O)N=C2N=CC=NC2C1=O |
| InChI | InChI=1S/C7H6N4O2/c1-11-6(12)4-5(10-7(11)13)9-3-2-8-4/h2-4H,1H3 |
| InChIKey | ILXWDZXBDNGVGN-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 74.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |