C9H10BrN4O2+ — CID 78446236
6-(bromomethyl)-1,3-dimethyl-4aH-pteridin-1-ium-2,4-dione (PubChem CID 78446236) has the molecular formula C9H10BrN4O2+ and a molecular weight of 286.11 g/mol. Its IUPAC name is 6-(bromomethyl)-1,3-dimethyl-4aH-pteridin-1-ium-2,4-dione.
| Compound Name | 6-(bromomethyl)-1,3-dimethyl-4aH-pteridin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 78446236 |
| Molecular Formula | C9H10BrN4O2+ |
| Molecular Weight | 286.11 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 6-(bromomethyl)-1,3-dimethyl-4aH-pteridin-1-ium-2,4-dione |
| SMILES | CN1C(=O)C2N=C(CBr)C=NC2=[N+](C)C1=O |
| InChI | InChI=1S/C9H10BrN4O2/c1-13-7-6(8(15)14(2)9(13)16)12-5(3-10)4-11-7/h4,6H,3H2,1-2H3/q+1 |
| InChIKey | HKYYWXOEFLCDFP-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 65.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.11 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|