C9H11N4O2+ — CID 78207141
1,3,6-trimethyl-4aH-pteridin-1-ium-2,4-dione (PubChem CID 78207141) has the molecular formula C9H11N4O2+ and a molecular weight of 207.21 g/mol. Its IUPAC name is 1,3,6-trimethyl-4aH-pteridin-1-ium-2,4-dione.
| Compound Name | 1,3,6-trimethyl-4aH-pteridin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 78207141 |
| Molecular Formula | C9H11N4O2+ |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 1,3,6-trimethyl-4aH-pteridin-1-ium-2,4-dione |
| SMILES | CC1=NC2C(=O)N(C)C(=O)[N+](C)=C2N=C1 |
| InChI | InChI=1S/C9H11N4O2/c1-5-4-10-7-6(11-5)8(14)13(3)9(15)12(7)2/h4,6H,1-3H3/q+1 |
| InChIKey | AUFFJYGMMNQUTN-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 65.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|