C10H13N4O2+ — CID 78175832
1,3,6,7-tetramethyl-4aH-pteridin-1-ium-2,4-dione (PubChem CID 78175832) has the molecular formula C10H13N4O2+ and a molecular weight of 221.24 g/mol. Its IUPAC name is 1,3,6,7-tetramethyl-4aH-pteridin-1-ium-2,4-dione.
| Compound Name | 1,3,6,7-tetramethyl-4aH-pteridin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 78175832 |
| Molecular Formula | C10H13N4O2+ |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 1,3,6,7-tetramethyl-4aH-pteridin-1-ium-2,4-dione |
| SMILES | CC1=NC2=[N+](C)C(=O)N(C)C(=O)C2N=C1C |
| InChI | InChI=1S/C10H13N4O2/c1-5-6(2)12-8-7(11-5)9(15)14(4)10(16)13(8)3/h7H,1-4H3/q+1 |
| InChIKey | YTMLYONLHWUENG-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 65.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|