C9H17N4O2+ — CID 71628297
5,6-diamino-1-butyl-3-methyl-5H-pyrimidin-1-ium-2,4-dione (PubChem CID 71628297) has the molecular formula C9H17N4O2+ and a molecular weight of 213.26 g/mol. Its IUPAC name is 5,6-diamino-1-butyl-3-methyl-5H-pyrimidin-1-ium-2,4-dione.
| Compound Name | 5,6-diamino-1-butyl-3-methyl-5H-pyrimidin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 71628297 |
| Molecular Formula | C9H17N4O2+ |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 5,6-diamino-1-butyl-3-methyl-5H-pyrimidin-1-ium-2,4-dione |
| SMILES | CCCC[N+]1=C(N)C(N)C(=O)N(C)C1=O |
| InChI | InChI=1S/C9H16N4O2/c1-3-4-5-13-7(11)6(10)8(14)12(2)9(13)15/h6,11H,3-5,10H2,1-2H3/p+1 |
| InChIKey | LZJZFPAFXSRCAD-UHFFFAOYSA-O |
| XLogP | -0.92 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|