C10H17N4O3+ — CID 75608240
butyl-(1,3-dimethyl-5-nitroso-2,6-dioxo-1,3-diazinan-4-ylidene)azanium (PubChem CID 75608240) has the molecular formula C10H17N4O3+ and a molecular weight of 241.27 g/mol. Its IUPAC name is butyl-(1,3-dimethyl-5-nitroso-2,6-dioxo-1,3-diazinan-4-ylidene)azanium.
| Compound Name | butyl-(1,3-dimethyl-5-nitroso-2,6-dioxo-1,3-diazinan-4-ylidene)azanium |
|---|---|
| PubChem CID | 75608240 |
| Molecular Formula | C10H17N4O3+ |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | butyl-(1,3-dimethyl-5-nitroso-2,6-dioxo-1,3-diazinan-4-ylidene)azanium |
| SMILES | CCCC/[NH+]=C1\C(N=O)C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C10H16N4O3/c1-4-5-6-11-8-7(12-17)9(15)14(3)10(16)13(8)2/h7H,4-6H2,1-3H3/p+1/b11-8+ |
| InChIKey | KUSRTLCKGJFDGT-DHZHZOJOSA-O |
| XLogP | -1.08 |
| TPSA | 84.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|