C24H23ClO4 — CID 78237975
[3-(4-chlorophenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3,4-dimethylbenzoate (PubChem CID 78237975) has the molecular formula C24H23ClO4 and a molecular weight of 410.90 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3,4-dimethylbenzoate.
| Compound Name | [3-(4-chlorophenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 78237975 |
| Molecular Formula | C24H23ClO4 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | [3-(4-chlorophenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)OC2CCC3C(=O)C(c4ccc(Cl)cc4)=COC3C2)cc1C |
| InChI | InChI=1S/C24H23ClO4/c1-14-3-4-17(11-15(14)2)24(27)29-19-9-10-20-22(12-19)28-13-21(23(20)26)16-5-7-18(25)8-6-16/h3-8,11,13,19-20,22H,9-10,12H2,1-2H3 |
| InChIKey | RKTTYGZYJMYDOL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |