C24H21NO5S — CID 78247665
[3-(1,3-benzothiazol-2-yl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 4-methoxybenzoate (PubChem CID 78247665) has the molecular formula C24H21NO5S and a molecular weight of 435.50 g/mol. Its IUPAC name is [3-(1,3-benzothiazol-2-yl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 4-methoxybenzoate.
| Compound Name | [3-(1,3-benzothiazol-2-yl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 78247665 |
| Molecular Formula | C24H21NO5S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | [3-(1,3-benzothiazol-2-yl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC2CCC3C(=O)C(c4nc5ccccc5s4)=COC3C2)cc1 |
| InChI | InChI=1S/C24H21NO5S/c1-28-15-8-6-14(7-9-15)24(27)30-16-10-11-17-20(12-16)29-13-18(22(17)26)23-25-19-4-2-3-5-21(19)31-23/h2-9,13,16-17,20H,10-12H2,1H3 |
| InChIKey | WISPLBQXZLACBB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |