C29H24N2O4S — CID 78254476
[3-(1,3-benzothiazol-2-yl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] N,N-diphenylcarbamate (PubChem CID 78254476) has the molecular formula C29H24N2O4S and a molecular weight of 496.59 g/mol. Its IUPAC name is [3-(1,3-benzothiazol-2-yl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] N,N-diphenylcarbamate.
| Compound Name | [3-(1,3-benzothiazol-2-yl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 78254476 |
| Molecular Formula | C29H24N2O4S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | [3-(1,3-benzothiazol-2-yl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] N,N-diphenylcarbamate |
| SMILES | O=C1C(c2nc3ccccc3s2)=COC2CC(OC(=O)N(c3ccccc3)c3ccccc3)CCC12 |
| InChI | InChI=1S/C29H24N2O4S/c32-27-22-16-15-21(17-25(22)34-18-23(27)28-30-24-13-7-8-14-26(24)36-28)35-29(33)31(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-14,18,21-22,25H,15-17H2 |
| InChIKey | HEFJRMOHKKMYGV-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |