C23H21N3O4 — CID 78319286
(1R,9S,16S,19S)-8-acetyl-17-methyl-10-oxa-8,17,23-triazahexacyclo[12.6.2.216,19.01,9.02,7.011,21]tetracosa-2,4,6,11(21),12,14(22)-hexaene-18,24-dione (PubChem CID 78319286) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is (1R,9S,16S,19S)-8-acetyl-17-methyl-10-oxa-8,17,23-triazahexacyclo[12.6.2.216,19.01,9.02,7.011,21]tetracosa-2,4,6,11(21),12,14(22)-hexaene-18,24-dione.
| Compound Name | (1R,9S,16S,19S)-8-acetyl-17-methyl-10-oxa-8,17,23-triazahexacyclo[12.6.2.216,19.01,9.02,7.011,21]tetracosa-2,4,6,11(21),12,14(22)-hexaene-18,24-dione |
|---|---|
| PubChem CID | 78319286 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (1R,9S,16S,19S)-8-acetyl-17-methyl-10-oxa-8,17,23-triazahexacyclo[12.6.2.216,19.01,9.02,7.011,21]tetracosa-2,4,6,11(21),12,14(22)-hexaene-18,24-dione |
| SMILES | CC(=O)N1c2ccccc2[C@]23C[C@@H]4NC(=O)[C@H](Cc5ccc(c2c5)O[C@H]13)N(C)C4=O |
| InChI | InChI=1S/C23H21N3O4/c1-12(27)26-17-6-4-3-5-14(17)23-11-16-21(29)25(2)18(20(28)24-16)10-13-7-8-19(15(23)9-13)30-22(23)26/h3-9,16,18,22H,10-11H2,1-2H3,(H,24,28)/t16-,18-,22-,23+/m0/s1 |
| InChIKey | IEKSZPYWHAWVMB-OPDBOEGZSA-N |
| XLogP | 1.33 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |