C16H15N3O7 — CID 7832941
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2-(2-nitrophenyl)acetate (PubChem CID 7832941) has the molecular formula C16H15N3O7 and a molecular weight of 361.31 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2-(2-nitrophenyl)acetate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2-(2-nitrophenyl)acetate |
|---|---|
| PubChem CID | 7832941 |
| Molecular Formula | C16H15N3O7 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2-(2-nitrophenyl)acetate |
| SMILES | O=C(COC(=O)Cc1ccccc1[N+](=O)[O-])NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C16H15N3O7/c20-14(18-16(22)17-9-12-5-3-7-25-12)10-26-15(21)8-11-4-1-2-6-13(11)19(23)24/h1-7H,8-10H2,(H2,17,18,20,22) |
| InChIKey | OTCPGHYIMZZLBH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 140.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|