C17H15ClN2O3S — CID 7847751
[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 5-(4-chlorophenyl)thiophene-2-carboxylate (PubChem CID 7847751) has the molecular formula C17H15ClN2O3S and a molecular weight of 362.84 g/mol. Its IUPAC name is [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 5-(4-chlorophenyl)thiophene-2-carboxylate.
| Compound Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 5-(4-chlorophenyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 7847751 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 5-(4-chlorophenyl)thiophene-2-carboxylate |
| SMILES | CN(CCC#N)C(=O)COC(=O)c1ccc(-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C17H15ClN2O3S/c1-20(10-2-9-19)16(21)11-23-17(22)15-8-7-14(24-15)12-3-5-13(18)6-4-12/h3-8H,2,10-11H2,1H3 |
| InChIKey | KWVWFVGYJYBGDD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |