C13H13Cl2N3O3 — CID 2399414
[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate (PubChem CID 2399414) has the molecular formula C13H13Cl2N3O3 and a molecular weight of 330.17 g/mol. Its IUPAC name is [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate.
| Compound Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 2399414 |
| Molecular Formula | C13H13Cl2N3O3 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 2-amino-3,5-dichlorobenzoate |
| SMILES | CN(CCC#N)C(=O)COC(=O)c1cc(Cl)cc(Cl)c1N |
| InChI | InChI=1S/C13H13Cl2N3O3/c1-18(4-2-3-16)11(19)7-21-13(20)9-5-8(14)6-10(15)12(9)17/h5-6H,2,4,7,17H2,1H3 |
| InChIKey | YQSHRYDMBUPHCR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|