C18H24F2N4O3S — CID 78842175
5-(azepan-1-ylsulfonyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methoxyaniline (PubChem CID 78842175) has the molecular formula C18H24F2N4O3S and a molecular weight of 414.48 g/mol. Its IUPAC name is 5-(azepan-1-ylsulfonyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methoxyaniline.
| Compound Name | 5-(azepan-1-ylsulfonyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methoxyaniline |
|---|---|
| PubChem CID | 78842175 |
| Molecular Formula | C18H24F2N4O3S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 5-(azepan-1-ylsulfonyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methoxyaniline |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCCC2)cc1NCc1nccn1C(F)F |
| InChI | InChI=1S/C18H24F2N4O3S/c1-27-16-7-6-14(28(25,26)23-9-4-2-3-5-10-23)12-15(16)22-13-17-21-8-11-24(17)18(19)20/h6-8,11-12,18,22H,2-5,9-10,13H2,1H3 |
| InChIKey | UHHIASIOYJSICX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |